Cofttek Holdings შეზღუდულია

GSK1070916 (942918-07)

GSK1070916 არის ძლიერი Aurora B / C კინაზას ინჰიბიტორი (ICXNUM 50 NM / 3.5 ერთად) ქსოვილის კულტურული უჯრედების და ადამიანის სიმსივნის xenograft მოდელების ფართო ანტიმოტორული აქტივობით.

არ არის განკუთვნილი თერაპიული გამოყენებისათვის. კვლევის გამოყენებისთვის მხოლოდ.

CAS: 942918-07-2 კატეგორია

GSK1070916 (942918-07) Description:

GSK1070916 არის Aurora kinases B და C (Kis = 0.38 და 1.5 NM), ძლიერი და ATP- ს კონკურენტუნარიანი ინჰიბიტორი.

ეს არის> Aurora B და C- ის არჩევითი შერჩევა Aurora A. GSK250- ის ინჰიბირებს ინექციურ ფილტვის კიბოს უჯრედების პროლეფერაციას (EC1070916 = 549). იგი ასევე ხელს უშლის პოლიპლოიტისა და აპოპტოზის ინდუქციის მეშვეობით 50 სიმსივნეების (EC7s = <100 NM) პანელის პროლიფერაციას. In Vivo, GSK50 ხელს უშლის Histone H10 ფოსფორილაციის კოლონოს X მაუსის xenograft მოდელი და იწვევს სიმსივნის რეგრესიის HL-XNUM თაგვის xenograft მოდელი. 1070916 ასევე ამცირებს სიმსივნის ზრდის 3 მაუსის xenograft მოდელები, მათ შორის მოდელები მკერდის, მსხვილი ნაწლავის და ფილტვის carcinomas ასევე ლეიკემიები.

GSK1070916 (942918-07) სpecifications:

პროდუქტის სახელი GSK1070916
სინონიმები რთული 17 [PMID 20420387]; 942918-07; GSK-2; GSK 1070916; UNII-1070916VB8V51HO; GSK-7A
ქიმიური სახელი 3-[4-[4-[2-[3-[(dimethylamino)methyl]phenyl]-1~{H}-pyrrolo[2,3-b]pyridin-4-yl]-1-ethylpyrazol-3-yl]phenyl]-1,1-dimethylurea
სიწმინდეს > 98%
CAS ნომერი 942918-07-2
მოლეკულური Fორმულა C30H33N7O
მოლეკულური Wრვა X
მონოსოტოპური მასა X
MDL ნომერი MFCD22420815
InChIKey QTBWCSQGBMPECM-UHFFFAOYSA-N
InChi კოდექსი InChI=1S/C30H33N7O/c1-6-37-19-26(28(34-37)21-10-12-23(13-11-21)32-30(38)36(4)5)24-14-15-31-29-25(24)17-27(33-29)22-9-7-8-20(16-22)18-35(2)3/h7-17,19H,6,18H2,1-5H3,(H,31,33)(H,32,38)
სიმები CCN1C=C(C(=N1)C2=CC=C(C=C2)NC(=O)N(C)C)C3=C4C=C(NC4=NC=C3)C5=CC(=CC=C5)CN(C)C
ფორმა ფხვნილი
ფერი N / A
Solubility ხსნადი DMSO- ში
Storage Temp. 0 - 4 მოკლევადიანი (დღე-ღამის განმავლობაში), ან -20 C ხანგრძლივობა (თვე).
ვარგისიანობის ვადა > 2 წლის თუ ინახება სწორად
Handling დაიცავით საჰაერო და მსუბუქი
განაცხადის Aurora Kinase B / C ინჰიბიტორი


=

RIDADR NONH ტრანსპორტის ყველა რეჟიმისთვის

ლიტერატურა:

  1. ადამსი, ND, ადამსი, JL, ბურგესი, JL, და სხვები. GSK1070916- ის აღმოჩენა, Aurora B / C kinase J. Med- ის ძლიერი და შერჩევითი ინჰიბიტორი. ჩემო. 53 (10), 3973-4001 (2010).
  2. Hardwicke, MA, Oleykowski, CA, მცენარეთა, RN, და სხვები. GSK1070916, ძლიერი Aurora B / C kinase ინჰიბიტორი ფართო antitumor საქმიანობის ქსოვილის კულტურის უჯრედების და ადამიანის სიმსივნის xenograft მოდელები Mol. კიბო. Ther. 8 (7), 1808-1817 (2009).