Urolithin B (1139-83-9) მწარმოებელი ქარხანა

უროლიტინი ბ

ნოემბერი 9, 2020

უროლიტინი BSpecifications

სახელი: უროლიტინი ბ
ქიმიური დასახელება: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
ქიმიური ფორმულა: C13H8O3
მოლეკულური წონა: X
ფერი:  თეთრი ფხვნილი
InChi გასაღები: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES კოდი: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ფუნქცია: უროლიტინ B- ს შეუძლია გააუმჯობესოს მიტოქონდრიული და კუნთების ფუნქციონირება.

უროლიტინ B- ს შეუძლია გააუმჯობესოს კუნთების ძალა და გამძლეობა დაბერების დროს.

განაცხადის: უროლიტინი B არის ელლაგიტანის ნაწლავის მიკრობული მეტაბოლიტი და ავლენს ძლიერ ანტიოქსიდანტურ და პროქსიდანტურ მოქმედებებს, რაც დამოკიდებულია ანალიზების სისტემასა და პირობებზე. უროლიტინ B- ს შეუძლია აგრეთვე გამოხატოს ესტროგენული და / ან ანესტროგენული მოქმედება.
ხსნადობა: ადვილად ხსნადი N, N-dimethylformamide და dimethylmethylene. სულფონი, ოდნავ ხსნადი მეთანოლში, ეთანოლში და ეთილის აცეტატში
შენახვის ტემპი: ჰიპროსკოპიური, -20 ° C საყინულე, ინერტული ატმოსფეროში
ტრანსპორტირების მდგომარეობა: ექსპლუატაციაში არსებული ტემპერატურის პირობებში, როგორც არასახიფათო ქიმიური ნივთიერება. ეს პროდუქტი სტაბილურია რამდენიმე კვირის განმავლობაში ჩვეულებრივი გადაზიდვისა და საბაჟო გადასახდელების დროს.