საუკეთესო უროლიტინის B ფხვნილი 1139 83-9-XNUMX) მწარმოებელი და ქარხანა

Urolithin B ფხვნილი

ნოემბერი 9, 2020

Cofttek არის საუკეთესო Urolithin B ფხვნილის მწარმოებელი ჩინეთში. ჩვენს ქარხანას აქვს წარმოების მართვის სრული სისტემა (ISO9001 და ISO14001), ყოველთვიური წარმოების მოცულობით 200 კგ.


სტატუსი: მასობრივი წარმოება
ერთეული: 1 კგ / ტომარა, 25 კგ / დრამი

უროლიტინი BSpecifications

სახელი: უროლიტინი ბ
ქიმიური დასახელება: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
ქიმიური ფორმულა: C13H8O3
მოლეკულური წონა: X
ფერი:  თეთრი ფხვნილი
SMILES კოდი: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ფუნქცია: უროლიტინ B- ს შეუძლია გააუმჯობესოს მიტოქონდრიული და კუნთების ფუნქციონირება.

უროლიტინ B- ს შეუძლია გააუმჯობესოს კუნთების ძალა და გამძლეობა დაბერების დროს.

განაცხადის: უროლიტინი B არის ელლაგიტანის ნაწლავის მიკრობული მეტაბოლიტი და ავლენს ძლიერ ანტიოქსიდანტურ და პროქსიდანტურ მოქმედებებს, რაც დამოკიდებულია ანალიზების სისტემასა და პირობებზე. უროლიტინ B- ს შეუძლია აგრეთვე გამოხატოს ესტროგენული და / ან ანესტროგენული მოქმედება.
ხსნადობა: ადვილად ხსნადი N, N-dimethylformamide და dimethylmethylene. სულფონი, ოდნავ ხსნადი მეთანოლში, ეთანოლში და ეთილის აცეტატში
შენახვის ტემპი: ჰიპროსკოპიური, -20 ° C საყინულე, ინერტული ატმოსფეროში
ტრანსპორტირების მდგომარეობა: ექსპლუატაციაში არსებული ტემპერატურის პირობებში, როგორც არასახიფათო ქიმიური ნივთიერება. ეს პროდუქტი სტაბილურია რამდენიმე კვირის განმავლობაში ჩვეულებრივი გადაზიდვისა და საბაჟო გადასახდელების დროს.


უროლიტინი ბ NMR სპექტრი

უროლიტინი B (1139-83-9) - NMR სპექტრი


თუ თქვენ გჭირდებათ COA, MSDS, HNMR პროდუქტის თითოეული პარტიისთვის და სხვა ინფორმაციისთვის, გთხოვთ, დაუკავშირდეთ ჩვენ მარკეტინგის მენეჯერი.


შესავალი Urolithins

Urolithins არის ელაგიტანნინებისგან მიღებული ელაგიური მჟავის მეორადი მეტაბოლიტები. ადამიანებში ელაგიტანინები ნაწლავის მიკროფლორით გარდაიქმნება ელაგიკურ მჟავად, რომელიც მსხვილ ნაწლავებში გარდაიქმნება urolithins A, urolithin B, urolithin C და urolithin D.

Urolithin A (UA) არის ელაგიტანინების ყველაზე გავრცელებული მეტაბოლიტი. ამასთან, ცნობილია, რომ urolithin A ბუნებრივად გვხვდება არცერთ დიეტურ წყაროში.

Urolithin B (UB) არის უხვი მეტაბოლიტი, რომელიც წარმოიქმნება ნაწლავში ელაგიტანინების ტრანსფორმაციის შედეგად. Urolithin B არის ბოლო პროდუქტი urolithin ყველა დანარჩენი წარმოებულების კატაბოლიზაციის შემდეგ. Urolithin B შარდში გვხვდება, როგორც urolithin B გლუკურონიდი.

Urolithin A 8-Methyl Ether არის შუალედური პროდუქტი Urolithin A.- ის სინთეზის დროს. იგი წარმოადგენს ელაგიტანინის მნიშვნელოვან მეორად მეტაბოლიტს და გააჩნია ანტიოქსიდანტური და ანთების საწინააღმდეგო თვისებები.


Urolithin A და B მოქმედების მექანიზმი

● Urolithin A იწვევს მიტოფაგიას

მიტოფაგი არის ავტოფაგიის ერთი ფორმა, რაც ხელს უწყობს დაზიანებული მიტოქონდრიის აღმოფხვრას მათი ოპტიმალური ფუნქციონირებისთვის. ავტოფაგა ეხება ზოგად პროცესს, რომლის დროსაც ციტოპლაზმური შინაარსი ხდება დეგრადირებული და, შესაბამისად, გადამუშავებული, ხოლო მიტოფაგია არის მიტოქონდრიის დეგრადაცია და გადამუშავება.

დაბერების დროს აუტოფაგიის შემცირება არის ერთ-ერთი ასპექტი, რომელიც იწვევს მიტოქონდრიული ფუნქციის დაქვეითებას. გარდა ამისა, ოქსიდაციურმა სტრესმა შეიძლება გამოიწვიოს დაბალი აუტოფაგია. Urolithin A ფლობს შესაძლებლობას, აღმოფხვრას დაზიანებული მიტოქონდრია შერჩევითი აუტოფაგიის საშუალებით.

● ანტიოქსიდანტური თვისებები

ჟანგვითი სტრესი ხდება, როდესაც სხეულში არსებობს დისბალანსი თავისუფალ რადიკალებსა და ანტიოქსიდანტს შორის. ეს ჭარბი თავისუფალი რადიკალები ხშირად უკავშირდება ბევრ ქრონიკულ დაავადებას, როგორიცაა გულის დარღვევები, დიაბეტი და კიბო.

უროლიტინები A და B ავლენენ ანტიოქსიდანტურ ეფექტებს მათი საშუალებით, რომ შეამცირონ თავისუფალი რადიკალების და კონკრეტულად უჯრედშიდა რეაქტიული ჟანგბადის სახეობები (ROS) დონეები და ასევე შეაჩერონ ლიპიდური პეროქსიდაცია გარკვეულ უჯრედულ ტიპებში.

გარდა ამისა, urolithins შეუძლია ინჰიბირება ზოგიერთი ჟანგვის ფერმენტების, მათ შორის monoamine oxidase A და tyrosinase.

● ანთების საწინააღმდეგო თვისებები

ანთება არის ბუნებრივი პროცესი, რომლის დროსაც ჩვენი სხეულები ებრძვიან ნებისმიერ დაცემულ ნივთს, როგორიცაა ინფექციები, დაზიანებები და მიკრობები. ამასთან, ქრონიკული ანთება შეიძლება საზიანო იყოს სხეულისთვის, რადგან ეს ასოცირდება სხვადასხვა დარღვევებთან, როგორიცაა ასთმა, გულის პრობლემები და კიბო. ქრონიკული ანთება შეიძლება მოხდეს სხეულის არანამკურნალევი მწვავე ანთების, ინფექციების ან თუნდაც თავისუფალი რადიკალების გამო.

უროლიტინები A და B ავლენენ ანთების საწინააღმდეგო თვისებებს აზოტის ოქსიდის წარმოების შეფერხებით. ისინი კონკრეტულად აფერხებენ ინდუქციურ აზოტის ოქსიდის სინთაზას (iNOS) ცილას და mRNA გამოხატვას, რომლებიც პასუხისმგებელნი არიან ანთებისთვის.

● ანტიმიკრობული მოქმედება

მიკრობები, ბაქტერიების, სოკოების და ვირუსების ჩათვლით, ბუნებრივად ვითარდება გარემოში და ადამიანის სხეულშიც კი. ამასთან, რამდენიმე მიკრობამ, რომელსაც პათოგენებად მოიხსენიებენ, შეიძლება გამოიწვიოს ინფექციური დაავადებები, როგორიცაა გრიპი, წითელა და მალარია.

უროლიტინ A- ს და B- ს შეუძლია გამოავლინოს ანტიმიკრობული მოქმედება ქვორუმის შეგრძნების ინჰიბირებით. კვორუმის შეხება არის ბაქტერიული კომუნიკაციის რეჟიმი, რომელიც საშუალებას აძლევს ბაქტერიებს გამოვლენონ და აკონტროლონ ინფექციურ პროცესებზე, როგორიცაა ვირუსულობა და მოტივაცია.

Protein ცილის გლიკაციის დათრგუნვა

გლიკაცია ეხება შაქრის ლიპიდს ან პროტეინს შაქრის არა ფერმენტულ მიერთებას. ეს არის ძირითადი ბიომარკი დიაბეტში და სხვა დარღვევებში, აგრეთვე ასაკში.

მაღალი ცილის გლიკაცია ჰიპერგლიკემიის მეორეხარისხოვან ეფექტს წარმოადგენს, მნიშვნელოვან როლს ასრულებს გულ-სისხლძარღვებთან დაკავშირებული დარღვევები, როგორიცაა დიაბეტი და ალცჰეიმერის დაავადება.

უროლიტინი A და B გააჩნიათ ანტიგლიკაციური თვისებები, რომლებიც დამოკიდებულია დოზაზე, რომელიც დამოუკიდებელია მათი ანტიოქსიდანტური მოქმედებისაგან.


უროლიტინის B სარგებელი

Urolithin B დამატებები ასევე შეიცავს ჯანმრთელობის რამდენიმე სარგებელს და რომელთა უმეტესობა უროლიტინის A- ს მსგავსია.

(1) კიბოს საწინააღმდეგო პოტენციალი
უროლიტინის B ანთების საწინააღმდეგო თვისებები მას კარგ კანდიდატად აყენებს კიბოს წინააღმდეგ. ზოგიერთმა მკვლევარმა გამოავლინა ეს პოტენციალი ფიბრობლასტებში, მიკროფაგებსა და ენდოთელურ უჯრედებში.

კვლევების თანახმად, UB აჩერებს სხვადასხვა სახის კიბოს, როგორიცაა პროსტატის, მსხვილი ნაწლავის და ბუშტის კიბო.

ადამიანის მსხვილი ნაწლავის კიბოს უჯრედებში ჩატარებული კვლევისას, ელლაგიტანინები, ელლაგინის მჟავა და უროლიტინები A და B შეფასებული იქნა მათი კიბოს საწინააღმდეგო პოტენციალისთვის. მათ განაცხადეს, რომ ყველა მკურნალობას ახერხებს კიბოს უჯრედების ზრდის შეფერხება. მათ შეაჩერეს კიბოს უჯრედების გამრავლება უჯრედული ციკლის დაპატიმრებით სხვადასხვა ფაზაში და ასევე აპოპტოზის გამოწვევით.

(2) დაგეხმარებათ ოქსიდაციური სტრესის წინააღმდეგ ბრძოლაში
Urolithin B ფლობს შესანიშნავ ანტიოქსიდანტურ თვისებებს რეაქტიული ჟანგბადის სახეობების დონის შემცირებისა და ლიპიდების პეროქსიდირების გზით უჯრედების გარკვეულ ტიპებში. ROS- ის მაღალი დონე ასოცირდება მრავალ დარღვევასთან, როგორიცაა ალცჰეიმერის დაავადება.

ჟანგვითი სტრესის ზემოქმედების ქვეშ მყოფი ნეირონული უჯრედების შესწავლისას, უროლიტინის B დანამატს, ისევე როგორც უროლიტინ A- ს, დაიცვან უჯრედები დაჟანგვისაგან და, შესაბამისად, გაიზარდა უჯრედების გადარჩენა.

(3) Urolithin B მეხსიერების გაძლიერებაში
მიღებულია urolithin b- ის გაუმჯობესების მიზნით სისხლის გამტარიანობა. ეს აძლიერებს კოგნიტურ ფუნქციონირებას.

გამოკვლევებმა აჩვენეს, რომ უროლიტინი B შეიძლება იყოს პოტენციური მეხსიერების გამაძლიერებელი ზოგადი შემეცნებითი ფუნქციის გაუმჯობესებით.

(4) ხელს უშლის კუნთების დაკარგვას
კუნთების დაქვეითება შეიძლება მოხდეს სხვადასხვა მიზეზების გამო, როგორიცაა დარღვევები, დაბერება და ცილის ნაკლებობა დიეტაში. კუნთების ცვენის შესაჩერებლად, შეზღუდვის ან უკეთესად დასადგენად საჭიროა მრავალი ღონისძიება, მათ შორის ვარჯიში, წამლები და ამინომჟავები, ისევე როგორც პოლიფენოლი.

უროლიტინები შეიძლება კლასიფიცირდეს პოლიფენოლებად და შეასრულოს როლი კუნთების დაკარგვის თავიდან ასაცილებლად კუნთების ცილის სინთეზის გააქტივებით და ასევე შეანელოს დეგრადაცია.

თაგვების კვლევისას, უროლიტინის B დანამატებმა მიიღეს კუნთების განვითარების გასაუმჯობესებლად, რადგან კუნთები უფრო დიდი იყო.

(5) Urolithin B ებრძვის ანთებას
უროლიტინი B ფლობს ანთების საწინააღმდეგო თვისებებს ანთების მარკერების უმეტესობის შემცირებით.

თირკმლის ფიბროზით ინდუცირებული ვირთაგვების დროს, უროლიტინ B- მა აღმოაჩინა თირკმელების დაზიანება. მან გააძლიერა თირკმლის ფუნქცია, თირკმლის მორფოლოგია, ასევე შეამცირა თირკმლის დაზიანების ნიშნები. ეს იმაზე მეტყველებს, რომ UB- მა შეძლო თირკმელების ანთების შემსუბუქება.

(6) A და B urolithin- ის სინერგიული სარგებელი
სინერგიული მოქმედებები ასევე დაფიქსირებულია urolithin A და B კომბინაციაში შემეცნებითი ფუნქციისა და შესაძლებლობების მიხედვით. კვლევაში ნათქვამია, რომ ეს კომბინაცია შეიძლება გამოყენებულ იქნას დემენციასთან დაკავშირებული დარღვევების სამკურნალოდ ან პროფილაქტიკაში, როგორიცაა შფოთვა ან ალცჰეიმერის დაავადება.

უროლიტინებთან დაკავშირებული სხვა სარგებელია;

  • neuroprotection
  • აუმჯობესებს მეტაბოლური სინდრომი


უროლიტინის A და B კვების წყაროები

უროლიტინები ბუნებრივად არ გვხვდება არცერთ დიეტურ წყაროში. ისინი წარმოადგენენ ელლაგური მჟავების ტრანსფორმაციის პროდუქტს, რომლებიც წარმოიქმნება ელლაგიტანინებისგან. ელაგიტანინები ნაწლავის მიკრობიად გადააქცევან ელინურ მჟავებად და ელიგას მჟავა შემდგომში გარდაიქმნება მის მეტაბოლიტებად (უროლიტინებად) მსხვილ ნაწლავებში.

ელაგიტანინები ბუნებრივად გვხვდება საკვების წყაროებში, როგორიცაა ბროწეული, კენკრა, მათ შორის მარწყვი, ჟოლო, ღრუბელი და მაყვალი, მუსკადინის ყურძენი, ნუში, გვავა, ჩაი და კაკალი, როგორიცაა კაკალი და წაბლი, ასევე მუხის ასაკის სასმელები, მაგალითად, წითელი ღვინო და ვისკი მუხის კასრები.

ამიტომ შეგვიძლია დავასკვნათ, რომ urolithin A საკვები და urolithin B საკვები არის ელაგიტანინით მდიდარი საკვები. აღსანიშნავია, რომ ელაგითანინის ბიოშეღწევადობა ძალზე შეზღუდულია, ხოლო მისი მეორადი მეტაბოლიტები (უროლიტინები) ადვილად ბიოშეღწევადი.

უროლიტინების გამოყოფა და წარმოება საკმაოდ განსხვავდება ინდივიდთა შორის, ვინაიდან ელაგიტანინებიდან გარდაქმნა ეყრდნობა ნაწლავებში არსებულ მიკრობიოტებს. ამ გარდაქმნაში მონაწილეობენ სპეციფიკური ბაქტერიები და განსხვავდება იმ პირთა შორის, სადაც ზოგს აქვს მაღალი, დაბალი ან მიუწვდომელი მიკრობიოტა. კვების წყარო ასევე განსხვავდება ელაგიტანინის დონის მიხედვით. აქედან გამომდინარე, ელაგიტანინების პოტენციური სარგებელი განსხვავდება ერთი ინდივიდიდან მეორეზე.


Urolithin A და B დამატებები

Urolithin A დამატებები, ისევე როგორც Urolithin B დამატებები ადვილად გვხვდება ბაზარზე, როგორც ellagitannin- ით მდიდარი საკვები წყაროების დანამატები. Urolithin A დამატებები ასევე ხელმისაწვდომია. ძირითადად ბროწეულის დანამატები ფართოდ გაიყიდა და წარმატებით გამოიყენება. ეს დანამატები სინთეზირდება ხილისგან ან კაკლისგან და ფორმულირდება თხევადი ან ფხვნილის სახით.

სხვადასხვა საკვებში ელაგითანინის კონცენტრაციის ვარიაციების გამო, უროლიტინის მომხმარებლები ყიდულობენ მას საკვების წყაროს გათვალისწინებით. იგივე ეხება urolithin B ფხვნილის ან თხევადი დამატებების მოპოვებისას.

რამდენიმე ადამიანის კლინიკურ გამოკვლევაში, ჩატარებული urolithin A ფხვნილით ან B- ით, არ გამოვლენილა რაიმე სერიოზული გვერდითი მოვლენა ამ დანამატების მიღებიდან.


  1. გარსია-მუნიოზი, კრისტინა; ვაილანტი, ფაბრისი (2014-12-02). "ელაგიტანინების მეტაბოლური ბედი: შედეგები ჯანმრთელობაზე და კვლევის პერსპექტივები ინოვაციური ფუნქციონალური საკვებისათვის". კრიტიკული მიმოხილვები კვების მეცნიერებაში და კვებაში.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 წლის 2009 ნოემბერი). ”უროლიტინები, ბროწეულის ელაგიტანინების ნაწლავური მიკრობული მეტაბოლიტები, ავლენენ ძლიერ ანტიოქსიდანტურ მოქმედებას უჯრედზე დაფუძნებულ ანალიზში”. J Agric Food Chem.
  3. ბოდველი, გრეჰემი; პოტი, იან; ნანდალურუ, პენჩალი (2011). ”უკუ ელექტრონული მოთხოვნილება დიელს-ოლდერზე დაფუძნებული მთლიანი სინთეზი უროლითინი M7”.


მიიღეთ ნაყარი ფასი